C18H33Cl2N5O5 — CID 77326585
6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoic acid;4-nitroaniline;dihydrochloride (PubChem CID 77326585) has the molecular formula C18H33Cl2N5O5 and a molecular weight of 470.40 g/mol. Its IUPAC name is 6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoic acid;4-nitroaniline;dihydrochloride.
| Compound Name | 6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoic acid;4-nitroaniline;dihydrochloride |
|---|---|
| PubChem CID | 77326585 |
| Molecular Formula | C18H33Cl2N5O5 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoic acid;4-nitroaniline;dihydrochloride |
| SMILES | CC(C)CC(N)C(=O)NC(CCCCN)C(=O)O.Cl.Cl.Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H25N3O3.C6H6N2O2.2ClH/c1-8(2)7-9(14)11(16)15-10(12(17)18)5-3-4-6-13;7-5-1-3-6(4-2-5)8(9)10;;/h8-10H,3-7,13-14H2,1-2H3,(H,15,16)(H,17,18);1-4H,7H2;2*1H |
| InChIKey | JYIDUOBBFUXSIT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 187.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|