C21H42N6O5S — CID 22704271
6-amino-2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]hexanoic acid (PubChem CID 22704271) has the molecular formula C21H42N6O5S and a molecular weight of 490.67 g/mol. Its IUPAC name is 6-amino-2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22704271 |
| Molecular Formula | C21H42N6O5S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 6-amino-2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]hexanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CS)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H42N6O5S/c1-13(2)11-14(24)18(28)27-17(12-33)20(30)25-15(7-3-5-9-22)19(29)26-16(21(31)32)8-4-6-10-23/h13-17,33H,3-12,22-24H2,1-2H3,(H,25,30)(H,26,29)(H,27,28)(H,31,32) |
| InChIKey | NGJJECAXHCVGDN-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|