C23H34N6O2 — CID 110180500
ethyl N-[2-amino-6-(nonylamino)-5-phenyldiazenyl-3-pyridinyl]carbamate (PubChem CID 110180500) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is ethyl N-[2-amino-6-(nonylamino)-5-phenyldiazenyl-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[2-amino-6-(nonylamino)-5-phenyldiazenyl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110180500 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | ethyl N-[2-amino-6-(nonylamino)-5-phenyldiazenyl-3-pyridinyl]carbamate |
| SMILES | CCCCCCCCCNc1nc(N)c(NC(=O)OCC)cc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C23H34N6O2/c1-3-5-6-7-8-9-13-16-25-22-20(29-28-18-14-11-10-12-15-18)17-19(21(24)27-22)26-23(30)31-4-2/h10-12,14-15,17H,3-9,13,16H2,1-2H3,(H,26,30)(H3,24,25,27)/b29-28+ |
| InChIKey | KETOZVJDBXPZGW-ZQHSETAFSA-N |
| XLogP | 6.81 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|