C19H21N5O5 — CID 164909098
[2-acetamido-6-(methoxycarbonylamino)-5-phenyldiazenyl-3-pyridinyl] butanoate (PubChem CID 164909098) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is [2-acetamido-6-(methoxycarbonylamino)-5-phenyldiazenyl-3-pyridinyl] butanoate.
| Compound Name | [2-acetamido-6-(methoxycarbonylamino)-5-phenyldiazenyl-3-pyridinyl] butanoate |
|---|---|
| PubChem CID | 164909098 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [2-acetamido-6-(methoxycarbonylamino)-5-phenyldiazenyl-3-pyridinyl] butanoate |
| SMILES | CCCC(=O)Oc1cc(/N=N/c2ccccc2)c(NC(=O)OC)nc1NC(C)=O |
| InChI | InChI=1S/C19H21N5O5/c1-4-8-16(26)29-15-11-14(24-23-13-9-6-5-7-10-13)17(22-19(27)28-3)21-18(15)20-12(2)25/h5-7,9-11H,4,8H2,1-3H3,(H2,20,21,22,25,27)/b24-23+ |
| InChIKey | YLSKUICPISSQFH-WCWDXBQESA-N |
| XLogP | 4.34 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|