C15H15N5O4 — CID 164909107
(6-acetamido-2-amino-5-phenyldiazenyl-3-pyridinyl) methyl carbonate (PubChem CID 164909107) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is (6-acetamido-2-amino-5-phenyldiazenyl-3-pyridinyl) methyl carbonate.
| Compound Name | (6-acetamido-2-amino-5-phenyldiazenyl-3-pyridinyl) methyl carbonate |
|---|---|
| PubChem CID | 164909107 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (6-acetamido-2-amino-5-phenyldiazenyl-3-pyridinyl) methyl carbonate |
| SMILES | COC(=O)Oc1cc(/N=N/c2ccccc2)c(NC(C)=O)nc1N |
| InChI | InChI=1S/C15H15N5O4/c1-9(21)17-14-11(20-19-10-6-4-3-5-7-10)8-12(13(16)18-14)24-15(22)23-2/h3-8H,1-2H3,(H3,16,17,18,21)/b20-19+ |
| InChIKey | LKCFBVJRGLUOCB-FMQUCBEESA-N |
| XLogP | 3.18 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|