About (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane
(6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane (PubChem CID 164909077) has the molecular formula C17H25N5O4
and a molecular weight of 363.42 g/mol. Its IUPAC name is (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane.
Molecular Properties
| Compound Name | (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane |
| PubChem CID | 164909077 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane |
| SMILES | CC.COC(=O)Oc1cc(N)c(NC(C)=O)nc1N.Nc1ccccc1 |
| InChI | InChI=1S/C9H12N4O4.C6H7N.C2H6/c1-4(14)12-8-5(10)3-6(7(11)13-8)17-9(15)16-2;7-6-4-2-1-3-5-6;1-2/h3H,10H2,1-2H3,(H3,11,12,13,14);1-5H,7H2;1-2H3 |
| InChIKey | IRUVPTZKXYAPRO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane?
The IUPAC name of (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane (CID 164909077) is (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane.
What is the SMILES notation for (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane?
The canonical SMILES for (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane is CC.COC(=O)Oc1cc(N)c(NC(C)=O)nc1N.Nc1ccccc1.
What is the InChIKey of (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane?
The InChIKey is IRUVPTZKXYAPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O4.C6H7N.C2H6/c1-4(14)12-8-5(10)3-6(7(11)13-8)17-9(15)16-2;7-6-4-2-1-3-5-6;1-2/h3H,10H2,1-2H3,(H3,11,12,13,14);1-5H,7H2;1-2H3.
What are the key properties of (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane?
(6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane has a molecular weight of 363.42 g/mol, XLogP of 2.64, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane is sourced from PubChem (CID 164909077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).