C17H25N5O4 — CID 164909077
(6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane (PubChem CID 164909077) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane.
| Compound Name | (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane |
|---|---|
| PubChem CID | 164909077 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (6-acetamido-2,5-diamino-3-pyridinyl) methyl carbonate;aniline;ethane |
| SMILES | CC.COC(=O)Oc1cc(N)c(NC(C)=O)nc1N.Nc1ccccc1 |
| InChI | InChI=1S/C9H12N4O4.C6H7N.C2H6/c1-4(14)12-8-5(10)3-6(7(11)13-8)17-9(15)16-2;7-6-4-2-1-3-5-6;1-2/h3H,10H2,1-2H3,(H3,11,12,13,14);1-5H,7H2;1-2H3 |
| InChIKey | IRUVPTZKXYAPRO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|