About (2-amino-4-methylphenyl) methyl carbonate
(2-amino-4-methylphenyl) methyl carbonate (PubChem CID 130705115) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is (2-amino-4-methylphenyl) methyl carbonate.
Molecular Properties
| Compound Name | (2-amino-4-methylphenyl) methyl carbonate |
| PubChem CID | 130705115 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (2-amino-4-methylphenyl) methyl carbonate |
| SMILES | COC(=O)Oc1ccc(C)cc1N |
| InChI | InChI=1S/C9H11NO3/c1-6-3-4-8(7(10)5-6)13-9(11)12-2/h3-5H,10H2,1-2H3 |
| InChIKey | AXNLBQFMMGQWON-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-4-methylphenyl) methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-methylphenyl) methyl carbonate?
The IUPAC name of (2-amino-4-methylphenyl) methyl carbonate (CID 130705115) is (2-amino-4-methylphenyl) methyl carbonate.
What is the SMILES notation for (2-amino-4-methylphenyl) methyl carbonate?
The canonical SMILES for (2-amino-4-methylphenyl) methyl carbonate is COC(=O)Oc1ccc(C)cc1N.
What is the InChIKey of (2-amino-4-methylphenyl) methyl carbonate?
The InChIKey is AXNLBQFMMGQWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-6-3-4-8(7(10)5-6)13-9(11)12-2/h3-5H,10H2,1-2H3.
What are the key properties of (2-amino-4-methylphenyl) methyl carbonate?
(2-amino-4-methylphenyl) methyl carbonate has a molecular weight of 181.19 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-methylphenyl) methyl carbonate is sourced from PubChem (CID 130705115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).