C30H24O18 — CID 20661198
methyl [3,6,7,10,11-pentakis(methoxycarbonyloxy)triphenylen-2-yl] carbonate (PubChem CID 20661198) has the molecular formula C30H24O18 and a molecular weight of 672.50 g/mol. Its IUPAC name is methyl [3,6,7,10,11-pentakis(methoxycarbonyloxy)triphenylen-2-yl] carbonate.
| Compound Name | methyl [3,6,7,10,11-pentakis(methoxycarbonyloxy)triphenylen-2-yl] carbonate |
|---|---|
| PubChem CID | 20661198 |
| Molecular Formula | C30H24O18 |
| Molecular Weight | 672.50 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | methyl [3,6,7,10,11-pentakis(methoxycarbonyloxy)triphenylen-2-yl] carbonate |
| SMILES | COC(=O)Oc1cc2c3cc(OC(=O)OC)c(OC(=O)OC)cc3c3cc(OC(=O)OC)c(OC(=O)OC)cc3c2cc1OC(=O)OC |
| InChI | InChI=1S/C30H24O18/c1-37-25(31)43-19-7-13-14(8-20(19)44-26(32)38-2)16-10-22(46-28(34)40-4)24(48-30(36)42-6)12-18(16)17-11-23(47-29(35)41-5)21(9-15(13)17)45-27(33)39-3/h7-12H,1-6H3 |
| InChIKey | QGKFCNONIZQQOM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|