About [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate
[2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate (PubChem CID 174260211) has the molecular formula C16H19N5O2
and a molecular weight of 313.36 g/mol. Its IUPAC name is [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate.
Molecular Properties
| Compound Name | [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate |
| PubChem CID | 174260211 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate |
| SMILES | CCCC(=O)Oc1cc(/N=N/c2ccc(C)cc2)c(N)nc1N |
| InChI | InChI=1S/C16H19N5O2/c1-3-4-14(22)23-13-9-12(15(17)19-16(13)18)21-20-11-7-5-10(2)6-8-11/h5-9H,3-4H2,1-2H3,(H4,17,18,19)/b21-20+ |
| InChIKey | NRAQOQLCLFQQGW-QZQOTICOSA-N |
| XLogP | 3.68 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate?
The IUPAC name of [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate (CID 174260211) is [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate.
What is the SMILES notation for [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate?
The canonical SMILES for [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate is CCCC(=O)Oc1cc(/N=N/c2ccc(C)cc2)c(N)nc1N.
What is the InChIKey of [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate?
The InChIKey is NRAQOQLCLFQQGW-QZQOTICOSA-N. The full InChI is InChI=1S/C16H19N5O2/c1-3-4-14(22)23-13-9-12(15(17)19-16(13)18)21-20-11-7-5-10(2)6-8-11/h5-9H,3-4H2,1-2H3,(H4,17,18,19)/b21-20+.
What are the key properties of [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate?
[2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate has a molecular weight of 313.36 g/mol, XLogP of 3.68, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate is sourced from PubChem (CID 174260211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).