C16H19N5O2 — CID 174260211
[2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate (PubChem CID 174260211) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate.
| Compound Name | [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate |
|---|---|
| PubChem CID | 174260211 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [2,6-diamino-5-[(4-methylphenyl)diazenyl]-3-pyridinyl] butanoate |
| SMILES | CCCC(=O)Oc1cc(/N=N/c2ccc(C)cc2)c(N)nc1N |
| InChI | InChI=1S/C16H19N5O2/c1-3-4-14(22)23-13-9-12(15(17)19-16(13)18)21-20-11-7-5-10(2)6-8-11/h5-9H,3-4H2,1-2H3,(H4,17,18,19)/b21-20+ |
| InChIKey | NRAQOQLCLFQQGW-QZQOTICOSA-N |
| XLogP | 3.68 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|