C39H44N2O6 — CID 101111452
[3-(4-hexoxybenzoyl)oxy-4-[(4-methylphenyl)diazenyl]phenyl] 4-hexoxybenzoate (PubChem CID 101111452) has the molecular formula C39H44N2O6 and a molecular weight of 636.79 g/mol. Its IUPAC name is [3-(4-hexoxybenzoyl)oxy-4-[(4-methylphenyl)diazenyl]phenyl] 4-hexoxybenzoate.
| Compound Name | [3-(4-hexoxybenzoyl)oxy-4-[(4-methylphenyl)diazenyl]phenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 101111452 |
| Molecular Formula | C39H44N2O6 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | [3-(4-hexoxybenzoyl)oxy-4-[(4-methylphenyl)diazenyl]phenyl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(C)cc3)c(OC(=O)c3ccc(OCCCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C39H44N2O6/c1-4-6-8-10-26-44-33-20-14-30(15-21-33)38(42)46-35-24-25-36(41-40-32-18-12-29(3)13-19-32)37(28-35)47-39(43)31-16-22-34(23-17-31)45-27-11-9-7-5-2/h12-25,28H,4-11,26-27H2,1-3H3/b41-40+ |
| InChIKey | WZYKUYADGRMEOQ-CDJCAARLSA-N |
| XLogP | 10.77 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|