C23H24N6O8 — CID 174260997
[2-[[2-amino-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 5-methyl-2-oxo-1,3-dioxole-4-carboxylate (PubChem CID 174260997) has the molecular formula C23H24N6O8 and a molecular weight of 512.48 g/mol. Its IUPAC name is [2-[[2-amino-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 5-methyl-2-oxo-1,3-dioxole-4-carboxylate.
| Compound Name | [2-[[2-amino-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 5-methyl-2-oxo-1,3-dioxole-4-carboxylate |
|---|---|
| PubChem CID | 174260997 |
| Molecular Formula | C23H24N6O8 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | [2-[[2-amino-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 5-methyl-2-oxo-1,3-dioxole-4-carboxylate |
| SMILES | Cc1oc(=O)oc1C(=O)Oc1ccccc1/N=N/c1ccc(NC(=O)CNC(=O)OC(C)(C)C)nc1N |
| InChI | InChI=1S/C23H24N6O8/c1-12-18(36-22(33)34-12)20(31)35-15-8-6-5-7-13(15)28-29-14-9-10-16(27-19(14)24)26-17(30)11-25-21(32)37-23(2,3)4/h5-10H,11H2,1-4H3,(H,25,32)(H3,24,26,27,30)/b29-28+ |
| InChIKey | GNSAHIRYXDIZQM-ZQHSETAFSA-N |
| XLogP | 3.62 |
| TPSA | 200.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|