C18H21N7O4 — CID 164909336
[2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] morpholine-4-carboxylate (PubChem CID 164909336) has the molecular formula C18H21N7O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is [2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] morpholine-4-carboxylate.
| Compound Name | [2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 164909336 |
| Molecular Formula | C18H21N7O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] morpholine-4-carboxylate |
| SMILES | NCC(=O)Nc1ccc(/N=N/c2ccccc2OC(=O)N2CCOCC2)c(N)n1 |
| InChI | InChI=1S/C18H21N7O4/c19-11-16(26)21-15-6-5-13(17(20)22-15)24-23-12-3-1-2-4-14(12)29-18(27)25-7-9-28-10-8-25/h1-6H,7-11,19H2,(H3,20,21,22,26)/b24-23+ |
| InChIKey | AHXMGCGGYPHTKD-WCWDXBQESA-N |
| XLogP | 1.81 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|