C15H14N4O6S — CID 87056849
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] morpholine-4-carboxylate (PubChem CID 87056849) has the molecular formula C15H14N4O6S and a molecular weight of 378.37 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] morpholine-4-carboxylate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 87056849 |
| Molecular Formula | C15H14N4O6S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] morpholine-4-carboxylate |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccccc1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H14N4O6S/c20-13(17-14-16-9-12(26-14)19(22)23)10-3-1-2-4-11(10)25-15(21)18-5-7-24-8-6-18/h1-4,9H,5-8H2,(H,16,17,20) |
| InChIKey | LEOMJGOAGLLEOJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|