C16H17N5O5S — CID 167361465
2-acetamido-3-(butanoylamino)-N-(5-nitro-1,3-thiazol-2-yl)benzamide (PubChem CID 167361465) has the molecular formula C16H17N5O5S and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-acetamido-3-(butanoylamino)-N-(5-nitro-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-acetamido-3-(butanoylamino)-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 167361465 |
| Molecular Formula | C16H17N5O5S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-acetamido-3-(butanoylamino)-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| SMILES | CCCC(=O)Nc1cccc(C(=O)Nc2ncc([N+](=O)[O-])s2)c1NC(C)=O |
| InChI | InChI=1S/C16H17N5O5S/c1-3-5-12(23)19-11-7-4-6-10(14(11)18-9(2)22)15(24)20-16-17-8-13(27-16)21(25)26/h4,6-8H,3,5H2,1-2H3,(H,18,22)(H,19,23)(H,17,20,24) |
| InChIKey | GZJBNZHPZTVBKQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|