C18H21N5O8S — CID 175453921
2-[2-[3-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]anilino]-3-oxopropoxy]ethoxy]ethyl carbamate (PubChem CID 175453921) has the molecular formula C18H21N5O8S and a molecular weight of 467.46 g/mol. Its IUPAC name is 2-[2-[3-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]anilino]-3-oxopropoxy]ethoxy]ethyl carbamate.
| Compound Name | 2-[2-[3-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]anilino]-3-oxopropoxy]ethoxy]ethyl carbamate |
|---|---|
| PubChem CID | 175453921 |
| Molecular Formula | C18H21N5O8S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[2-[3-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]anilino]-3-oxopropoxy]ethoxy]ethyl carbamate |
| SMILES | NC(=O)OCCOCCOCCC(=O)Nc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C18H21N5O8S/c19-17(26)31-10-9-30-8-7-29-6-5-14(24)21-13-4-2-1-3-12(13)16(25)22-18-20-11-15(32-18)23(27)28/h1-4,11H,5-10H2,(H2,19,26)(H,21,24)(H,20,22,25) |
| InChIKey | YPAQCKWQFZPXEH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 185.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|