C24H32N6O3 — CID 164908660
[2-[(6-amino-2-ethyl-3-pyridinyl)diazenyl]phenyl] 4-(1,4-oxazepan-4-yl)piperidine-1-carboxylate (PubChem CID 164908660) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is [2-[(6-amino-2-ethyl-3-pyridinyl)diazenyl]phenyl] 4-(1,4-oxazepan-4-yl)piperidine-1-carboxylate.
| Compound Name | [2-[(6-amino-2-ethyl-3-pyridinyl)diazenyl]phenyl] 4-(1,4-oxazepan-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164908660 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | [2-[(6-amino-2-ethyl-3-pyridinyl)diazenyl]phenyl] 4-(1,4-oxazepan-4-yl)piperidine-1-carboxylate |
| SMILES | CCc1nc(N)ccc1/N=N/c1ccccc1OC(=O)N1CCC(N2CCCOCC2)CC1 |
| InChI | InChI=1S/C24H32N6O3/c1-2-19-20(8-9-23(25)26-19)27-28-21-6-3-4-7-22(21)33-24(31)30-13-10-18(11-14-30)29-12-5-16-32-17-15-29/h3-4,6-9,18H,2,5,10-17H2,1H3,(H2,25,26)/b28-27+ |
| InChIKey | IETPBKSKXWRHRB-BYYHNAKLSA-N |
| XLogP | 4.33 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|