C20H26N6O2 — CID 174262403
[2-[(2,4-diaminophenyl)diazenyl]phenyl] 4-(dimethylamino)piperidine-1-carboxylate (PubChem CID 174262403) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is [2-[(2,4-diaminophenyl)diazenyl]phenyl] 4-(dimethylamino)piperidine-1-carboxylate.
| Compound Name | [2-[(2,4-diaminophenyl)diazenyl]phenyl] 4-(dimethylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174262403 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [2-[(2,4-diaminophenyl)diazenyl]phenyl] 4-(dimethylamino)piperidine-1-carboxylate |
| SMILES | CN(C)C1CCN(C(=O)Oc2ccccc2/N=N/c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C20H26N6O2/c1-25(2)15-9-11-26(12-10-15)20(27)28-19-6-4-3-5-18(19)24-23-17-8-7-14(21)13-16(17)22/h3-8,13,15H,9-12,21-22H2,1-2H3/b24-23+ |
| InChIKey | HFSYEDQLPZGUCK-WCWDXBQESA-N |
| XLogP | 3.79 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|