C14H22N4O — CID 61092236
2,4-diamino-N-methyl-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 61092236) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2,4-diamino-N-methyl-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 2,4-diamino-N-methyl-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 61092236 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2,4-diamino-N-methyl-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CN1CCC(N(C)C(=O)c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C14H22N4O/c1-17-7-5-11(6-8-17)18(2)14(19)12-4-3-10(15)9-13(12)16/h3-4,9,11H,5-8,15-16H2,1-2H3 |
| InChIKey | PAFKMJYHWQUOFG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|