C16H24ClN3O — CID 61138918
2-amino-4-chloro-N-methyl-N-(1-propylpiperidin-4-yl)benzamide (PubChem CID 61138918) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-amino-4-chloro-N-methyl-N-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | 2-amino-4-chloro-N-methyl-N-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 61138918 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-amino-4-chloro-N-methyl-N-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCN1CCC(N(C)C(=O)c2ccc(Cl)cc2N)CC1 |
| InChI | InChI=1S/C16H24ClN3O/c1-3-8-20-9-6-13(7-10-20)19(2)16(21)14-5-4-12(17)11-15(14)18/h4-5,11,13H,3,6-10,18H2,1-2H3 |
| InChIKey | LQVGJHCHAZSFCS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|