C16H26N4O — CID 61105123
2,4-diamino-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide (PubChem CID 61105123) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2,4-diamino-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide.
| Compound Name | 2,4-diamino-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 61105123 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2,4-diamino-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
| SMILES | CC(C)N1CCC(N(C)C(=O)c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C16H26N4O/c1-11(2)20-8-6-13(7-9-20)19(3)16(21)14-5-4-12(17)10-15(14)18/h4-5,10-11,13H,6-9,17-18H2,1-3H3 |
| InChIKey | SDRIOMHUHAZKJW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|