C17H25FN2O — CID 62510083
2-fluoro-N,5-dimethyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide (PubChem CID 62510083) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-fluoro-N,5-dimethyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide.
| Compound Name | 2-fluoro-N,5-dimethyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 62510083 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-fluoro-N,5-dimethyl-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(C)C2CCN(C(C)C)CC2)c1 |
| InChI | InChI=1S/C17H25FN2O/c1-12(2)20-9-7-14(8-10-20)19(4)17(21)15-11-13(3)5-6-16(15)18/h5-6,11-12,14H,7-10H2,1-4H3 |
| InChIKey | UNAYSPUULCJCSD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |