C15H20FNO — CID 62510377
N-cyclohexyl-2-fluoro-N,5-dimethylbenzamide (PubChem CID 62510377) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is N-cyclohexyl-2-fluoro-N,5-dimethylbenzamide.
| Compound Name | N-cyclohexyl-2-fluoro-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 62510377 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-cyclohexyl-2-fluoro-N,5-dimethylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C15H20FNO/c1-11-8-9-14(16)13(10-11)15(18)17(2)12-6-4-3-5-7-12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | CVGQAZULMJVZFT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |