C13H22Cl2N4O2 — CID 119868276
N-[4-[(2-aminoacetyl)amino]phenyl]-3-(dimethylamino)propanamide;dihydrochloride (PubChem CID 119868276) has the molecular formula C13H22Cl2N4O2 and a molecular weight of 337.25 g/mol. Its IUPAC name is N-[4-[(2-aminoacetyl)amino]phenyl]-3-(dimethylamino)propanamide;dihydrochloride.
| Compound Name | N-[4-[(2-aminoacetyl)amino]phenyl]-3-(dimethylamino)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119868276 |
| Molecular Formula | C13H22Cl2N4O2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[4-[(2-aminoacetyl)amino]phenyl]-3-(dimethylamino)propanamide;dihydrochloride |
| SMILES | CN(C)CCC(=O)Nc1ccc(NC(=O)CN)cc1.Cl.Cl |
| InChI | InChI=1S/C13H20N4O2.2ClH/c1-17(2)8-7-12(18)15-10-3-5-11(6-4-10)16-13(19)9-14;;/h3-6H,7-9,14H2,1-2H3,(H,15,18)(H,16,19);2*1H |
| InChIKey | QKXCNKXYXQGAAG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |