C15H22N4O — CID 95026394
(6-amino-3-pyridinyl)-[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methanone (PubChem CID 95026394) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is (6-amino-3-pyridinyl)-[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methanone.
| Compound Name | (6-amino-3-pyridinyl)-[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95026394 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (6-amino-3-pyridinyl)-[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CC[C@@H](N3CCCCC3)C2)cn1 |
| InChI | InChI=1S/C15H22N4O/c16-14-5-4-12(10-17-14)15(20)19-9-6-13(11-19)18-7-2-1-3-8-18/h4-5,10,13H,1-3,6-9,11H2,(H2,16,17)/t13-/m1/s1 |
| InChIKey | XMFJYWYBAIZOBB-CYBMUJFWSA-N |
| XLogP | 1.36 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |