About 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid
1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid (PubChem CID 86284034) has the molecular formula C17H24N4O4
and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid.
Molecular Properties
| Compound Name | 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid |
| PubChem CID | 86284034 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid |
| SMILES | Nc1ccc(C(=O)N2CCN(C3CCOCC3)CC(C(=O)O)C2)cn1 |
| InChI | InChI=1S/C17H24N4O4/c18-15-2-1-12(9-19-15)16(22)21-6-5-20(10-13(11-21)17(23)24)14-3-7-25-8-4-14/h1-2,9,13-14H,3-8,10-11H2,(H2,18,19)(H,23,24) |
| InChIKey | AQLSEHWCWGWJEW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid?
The IUPAC name of 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid (CID 86284034) is 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid.
What is the SMILES notation for 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid?
The canonical SMILES for 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid is Nc1ccc(C(=O)N2CCN(C3CCOCC3)CC(C(=O)O)C2)cn1.
What is the InChIKey of 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid?
The InChIKey is AQLSEHWCWGWJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O4/c18-15-2-1-12(9-19-15)16(22)21-6-5-20(10-13(11-21)17(23)24)14-3-7-25-8-4-14/h1-2,9,13-14H,3-8,10-11H2,(H2,18,19)(H,23,24).
What are the key properties of 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid?
1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid has a molecular weight of 348.40 g/mol, XLogP of 0.30, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-aminopyridine-3-carbonyl)-4-(oxan-4-yl)-1,4-diazepane-6-carboxylic acid is sourced from PubChem (CID 86284034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).