C15H21NO — CID 10308007
2-(2-methoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 10308007) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 2-(2-methoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 10308007 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | COc1ccccc1C1CC2CCCCN2C1 |
| InChI | InChI=1S/C15H21NO/c1-17-15-8-3-2-7-14(15)12-10-13-6-4-5-9-16(13)11-12/h2-3,7-8,12-13H,4-6,9-11H2,1H3 |
| InChIKey | CKQLDESBQIPEMG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |