C14H19N — CID 13451069
2-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 13451069) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 2-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 13451069 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | c1ccc(C2CC3CCCCN3C2)cc1 |
| InChI | InChI=1S/C14H19N/c1-2-6-12(7-3-1)13-10-14-8-4-5-9-15(14)11-13/h1-3,6-7,13-14H,4-5,8-11H2 |
| InChIKey | JKECMGSANFSNJV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |