C23H40N2O2 — CID 171567539
(7aS)-1-methyl-6-pyrrolidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;1,2-dimethoxybenzene;ethane (PubChem CID 171567539) has the molecular formula C23H40N2O2 and a molecular weight of 376.59 g/mol. Its IUPAC name is (7aS)-1-methyl-6-pyrrolidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;1,2-dimethoxybenzene;ethane.
| Compound Name | (7aS)-1-methyl-6-pyrrolidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;1,2-dimethoxybenzene;ethane |
|---|---|
| PubChem CID | 171567539 |
| Molecular Formula | C23H40N2O2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | (7aS)-1-methyl-6-pyrrolidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;1,2-dimethoxybenzene;ethane |
| SMILES | CC.CN1CCC2CCC(N3CCCC3)C[C@@H]21.COc1ccccc1OC |
| InChI | InChI=1S/C13H24N2.C8H10O2.C2H6/c1-14-9-6-11-4-5-12(10-13(11)14)15-7-2-3-8-15;1-9-7-5-3-4-6-8(7)10-2;1-2/h11-13H,2-10H2,1H3;3-6H,1-2H3;1-2H3/t11?,12?,13-;;/m0../s1 |
| InChIKey | SDZYQKOIQSINIO-HCXYENKBSA-N |
| XLogP | 4.68 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |