C17H26NO5P — CID 170747084
1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) dihydrogen phosphite (PubChem CID 170747084) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) dihydrogen phosphite.
| Compound Name | 1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) dihydrogen phosphite |
|---|---|
| PubChem CID | 170747084 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) dihydrogen phosphite |
| SMILES | CN1CCC2CCC(OP(O)O)=CC21.COc1ccccc1OC |
| InChI | InChI=1S/C9H16NO3P.C8H10O2/c1-10-5-4-7-2-3-8(6-9(7)10)13-14(11)12;1-9-7-5-3-4-6-8(7)10-2/h6-7,9,11-12H,2-5H2,1H3;3-6H,1-2H3 |
| InChIKey | IBMOURFQFHVLEN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|