C22H21F3N2O5 — CID 10575530
dimethyl (1S,11S,12R,13E)-13-ethylidene-15-(2,2,2-trifluoroacetyl)-3,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-3,11-dicarboxylate (PubChem CID 10575530) has the molecular formula C22H21F3N2O5 and a molecular weight of 450.41 g/mol. Its IUPAC name is dimethyl (1S,11S,12R,13E)-13-ethylidene-15-(2,2,2-trifluoroacetyl)-3,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-3,11-dicarboxylate.
| Compound Name | dimethyl (1S,11S,12R,13E)-13-ethylidene-15-(2,2,2-trifluoroacetyl)-3,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-3,11-dicarboxylate |
|---|---|
| PubChem CID | 10575530 |
| Molecular Formula | C22H21F3N2O5 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | dimethyl (1S,11S,12R,13E)-13-ethylidene-15-(2,2,2-trifluoroacetyl)-3,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-3,11-dicarboxylate |
| SMILES | C/C=C1/CN(C(=O)C(F)(F)F)[C@H]2C[C@@H]1[C@H](C(=O)OC)c1c2n(C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C22H21F3N2O5/c1-4-11-10-26(20(29)22(23,24)25)15-9-13(11)17(19(28)31-2)16-12-7-5-6-8-14(12)27(18(15)16)21(30)32-3/h4-8,13,15,17H,9-10H2,1-3H3/b11-4-/t13-,15-,17-/m0/s1 |
| InChIKey | QTPZEZJWADUQIZ-OEQMFVPNSA-N |
| XLogP | 3.92 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|