C21H26N2O3 — CID 10066723
methyl (1S,11R,12S,13E)-13-ethylidene-15-(3-hydroxypropyl)-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate (PubChem CID 10066723) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl (1S,11R,12S,13E)-13-ethylidene-15-(3-hydroxypropyl)-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate.
| Compound Name | methyl (1S,11R,12S,13E)-13-ethylidene-15-(3-hydroxypropyl)-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 10066723 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | methyl (1S,11R,12S,13E)-13-ethylidene-15-(3-hydroxypropyl)-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate |
| SMILES | C/C=C1/CN(CCCO)[C@H]2C[C@@H]1[C@H](C(=O)OC)n1c2cc2ccccc21 |
| InChI | InChI=1S/C21H26N2O3/c1-3-14-13-22(9-6-10-24)18-12-16(14)20(21(25)26-2)23-17-8-5-4-7-15(17)11-19(18)23/h3-5,7-8,11,16,18,20,24H,6,9-10,12-13H2,1-2H3/b14-3-/t16-,18-,20+/m0/s1 |
| InChIKey | KLRWDHFMQCEXQE-AUGPPEKFSA-N |
| XLogP | 3.06 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|