C21H25ClN2O2 — CID 10429398
methyl (1S,11S,12S,13E)-3-(2-chloroethyl)-13-ethylidene-15-methyl-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate (PubChem CID 10429398) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is methyl (1S,11S,12S,13E)-3-(2-chloroethyl)-13-ethylidene-15-methyl-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate.
| Compound Name | methyl (1S,11S,12S,13E)-3-(2-chloroethyl)-13-ethylidene-15-methyl-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 10429398 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | methyl (1S,11S,12S,13E)-3-(2-chloroethyl)-13-ethylidene-15-methyl-10,15-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2,4,6,8-tetraene-11-carboxylate |
| SMILES | C/C=C1/CN(C)[C@H]2C[C@@H]1[C@@H](C(=O)OC)n1c2c(CCCl)c2ccccc21 |
| InChI | InChI=1S/C21H25ClN2O2/c1-4-13-12-23(2)18-11-16(13)20(21(25)26-3)24-17-8-6-5-7-14(17)15(9-10-22)19(18)24/h4-8,16,18,20H,9-12H2,1-3H3/b13-4-/t16-,18-,20-/m0/s1 |
| InChIKey | CNCMUIMKDWKQFI-ULGYPZFWSA-N |
| XLogP | 4.09 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|