C24H28N2O5 — CID 5378653
methyl 6-acetyl-3-[(Z)-1-acetyloxybut-2-en-2-yl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-2-carboxylate (PubChem CID 5378653) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl 6-acetyl-3-[(Z)-1-acetyloxybut-2-en-2-yl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-2-carboxylate.
| Compound Name | methyl 6-acetyl-3-[(Z)-1-acetyloxybut-2-en-2-yl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-2-carboxylate |
|---|---|
| PubChem CID | 5378653 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl 6-acetyl-3-[(Z)-1-acetyloxybut-2-en-2-yl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-2-carboxylate |
| SMILES | C/C=C(\COC(C)=O)C1CC2c3c(c4ccccc4n3C1C(=O)OC)CCN2C(C)=O |
| InChI | InChI=1S/C24H28N2O5/c1-5-16(13-31-15(3)28)19-12-21-22-18(10-11-25(21)14(2)27)17-8-6-7-9-20(17)26(22)23(19)24(29)30-4/h5-9,19,21,23H,10-13H2,1-4H3/b16-5+ |
| InChIKey | COLLOARIWHQYDM-FZSIALSZSA-N |
| XLogP | 3.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|