C26H36N2O5 — CID 145462767
ethane;[2-[1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl] acetate;methyl acetate (PubChem CID 145462767) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is ethane;[2-[1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl] acetate;methyl acetate.
| Compound Name | ethane;[2-[1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl] acetate;methyl acetate |
|---|---|
| PubChem CID | 145462767 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | ethane;[2-[1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl] acetate;methyl acetate |
| SMILES | C/C=C\C(=C/C)C1c2[nH]c3ccccc3c2CCN1C(=O)COC(C)=O.CC.COC(C)=O |
| InChI | InChI=1S/C21H24N2O3.C3H6O2.C2H6/c1-4-8-15(5-2)21-20-17(16-9-6-7-10-18(16)22-20)11-12-23(21)19(25)13-26-14(3)24;1-3(4)5-2;1-2/h4-10,21-22H,11-13H2,1-3H3;1-2H3;1-2H3/b8-4-,15-5+;; |
| InChIKey | XGSKOEVWCIRZJU-ZENBDUMXSA-N |
| XLogP | 4.88 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|