C24H26N2O4 — CID 122402845
ethyl (1R)-1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 122402845) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl (1R)-1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | ethyl (1R)-1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 122402845 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl (1R)-1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H26N2O4/c1-4-30-24(27)26-14-13-18-17-7-5-6-8-19(17)25-23(18)20(26)11-9-16-10-12-21(28-2)22(15-16)29-3/h5-12,15,20,25H,4,13-14H2,1-3H3/b11-9+/t20-/m1/s1 |
| InChIKey | IDIMKEMYEULHBR-WAEYIKQSSA-N |
| XLogP | 4.95 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|