C33H42N2O2 — CID 102422352
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R)-1-[(E)-pent-1-enyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 102422352) has the molecular formula C33H42N2O2 and a molecular weight of 498.71 g/mol. Its IUPAC name is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R)-1-[(E)-pent-1-enyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R)-1-[(E)-pent-1-enyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 102422352 |
| Molecular Formula | C33H42N2O2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R)-1-[(E)-pent-1-enyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCC/C=C/[C@@H]1c2[nH]c3ccccc3c2CCN1C(=O)OC1CC(C)CCC1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C33H42N2O2/c1-5-6-8-17-29-31-26(25-15-11-12-16-28(25)34-31)20-21-35(29)32(36)37-30-22-23(2)18-19-27(30)33(3,4)24-13-9-7-10-14-24/h7-17,23,27,29-30,34H,5-6,18-22H2,1-4H3/b17-8+/t23?,27?,29-,30?/m1/s1 |
| InChIKey | SLPRIMZZOQDPBU-NLMCVONYSA-N |
| XLogP | 8.34 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|