C23H35NO3 — CID 75954697
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-methoxypiperidine-1-carboxylate (PubChem CID 75954697) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-methoxypiperidine-1-carboxylate.
| Compound Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 75954697 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-methoxypiperidine-1-carboxylate |
| SMILES | COC1CCCCN1C(=O)OC1CC(C)CCC1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H35NO3/c1-17-13-14-19(23(2,3)18-10-6-5-7-11-18)20(16-17)27-22(25)24-15-9-8-12-21(24)26-4/h5-7,10-11,17,19-21H,8-9,12-16H2,1-4H3 |
| InChIKey | WBDSRLTWUNMTKU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |