C30H41NO3 — CID 122404202
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-1-(4-methoxyphenyl)azepane-2-carboxylate (PubChem CID 122404202) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-1-(4-methoxyphenyl)azepane-2-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-1-(4-methoxyphenyl)azepane-2-carboxylate |
|---|---|
| PubChem CID | 122404202 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-1-(4-methoxyphenyl)azepane-2-carboxylate |
| SMILES | COc1ccc(N2CCCCC[C@H]2C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H41NO3/c1-22-14-19-26(30(2,3)23-11-7-5-8-12-23)28(21-22)34-29(32)27-13-9-6-10-20-31(27)24-15-17-25(33-4)18-16-24/h5,7-8,11-12,15-18,22,26-28H,6,9-10,13-14,19-21H2,1-4H3/t22-,26-,27+,28-/m1/s1 |
| InChIKey | XOJXOFCKYSTCFE-HLJLCZKJSA-N |
| XLogP | 6.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|