C40H44N2O4 — CID 102122217
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S,4R)-4,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole-3-carboxylate (PubChem CID 102122217) has the molecular formula C40H44N2O4 and a molecular weight of 616.80 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S,4R)-4,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole-3-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S,4R)-4,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 102122217 |
| Molecular Formula | C40H44N2O4 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S,4R)-4,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole-3-carboxylate |
| SMILES | COc1ccc(C2=NN(c3ccccc3)[C@H](C(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)c3ccccc3)[C@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H44N2O4/c1-27-16-25-34(40(2,3)30-12-8-6-9-13-30)35(26-27)46-39(43)38-36(28-17-21-32(44-4)22-18-28)37(29-19-23-33(45-5)24-20-29)41-42(38)31-14-10-7-11-15-31/h6-15,17-24,27,34-36,38H,16,25-26H2,1-5H3/t27-,34-,35-,36+,38+/m1/s1 |
| InChIKey | XZEYFGKSSBUGBX-ZCVXIJROSA-N |
| XLogP | 8.41 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |