C27H34F3NO3 — CID 11005301
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate (PubChem CID 11005301) has the molecular formula C27H34F3NO3 and a molecular weight of 477.57 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate |
|---|---|
| PubChem CID | 11005301 |
| Molecular Formula | C27H34F3NO3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate |
| SMILES | COc1ccc(N[C@@H](CC(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H34F3NO3/c1-18-10-15-22(26(2,3)19-8-6-5-7-9-19)23(16-18)34-25(32)17-24(27(28,29)30)31-20-11-13-21(33-4)14-12-20/h5-9,11-14,18,22-24,31H,10,15-17H2,1-4H3/t18-,22-,23-,24+/m1/s1 |
| InChIKey | IAQRJOADGAXOPB-WJXFIBLPSA-N |
| XLogP | 6.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|