C21H30F3NO3 — CID 11058479
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate (PubChem CID 11058479) has the molecular formula C21H30F3NO3 and a molecular weight of 401.47 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate |
|---|---|
| PubChem CID | 11058479 |
| Molecular Formula | C21H30F3NO3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-4,4,4-trifluoro-3-(4-methoxyanilino)butanoate |
| SMILES | COc1ccc(N[C@@H](CC(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H30F3NO3/c1-13(2)17-10-5-14(3)11-18(17)28-20(26)12-19(21(22,23)24)25-15-6-8-16(27-4)9-7-15/h6-9,13-14,17-19,25H,5,10-12H2,1-4H3/t14-,17+,18-,19+/m1/s1 |
| InChIKey | FQZSOHNSUJGUCV-FDPIWHGQSA-N |
| XLogP | 5.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|