C18H28NO3+ — CID 58592321
(5-methyl-2-propan-2-ylcyclohexyl) 2-(4-methoxypyridin-1-ium-1-yl)acetate (PubChem CID 58592321) has the molecular formula C18H28NO3+ and a molecular weight of 306.43 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-methoxypyridin-1-ium-1-yl)acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-methoxypyridin-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 58592321 |
| Molecular Formula | C18H28NO3+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-methoxypyridin-1-ium-1-yl)acetate |
| SMILES | COc1cc[n+](CC(=O)OC2CC(C)CCC2C(C)C)cc1 |
| InChI | InChI=1S/C18H28NO3/c1-13(2)16-6-5-14(3)11-17(16)22-18(20)12-19-9-7-15(21-4)8-10-19/h7-10,13-14,16-17H,5-6,11-12H2,1-4H3/q+1 |
| InChIKey | MABXEHKCPZKLDC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|