C18H27N2O3+ — CID 2853381
(5-methyl-2-propan-2-ylcyclohexyl) 2-(3-carbamoylpyridin-1-ium-1-yl)acetate (PubChem CID 2853381) has the molecular formula C18H27N2O3+ and a molecular weight of 319.43 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-carbamoylpyridin-1-ium-1-yl)acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-carbamoylpyridin-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 2853381 |
| Molecular Formula | C18H27N2O3+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-carbamoylpyridin-1-ium-1-yl)acetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C[n+]2cccc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-12(2)15-7-6-13(3)9-16(15)23-17(21)11-20-8-4-5-14(10-20)18(19)22/h4-5,8,10,12-13,15-16H,6-7,9,11H2,1-3H3,(H-,19,22)/p+1 |
| InChIKey | OYBMWAADGKMVPE-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|