C30H39F2NO3 — CID 42640324
trans-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,2S)-3,3-difluoro-2-(4-methoxyanilino)cyclohexane-1-carboxylate (PubChem CID 42640324) has the molecular formula C30H39F2NO3 and a molecular weight of 499.64 g/mol. Its IUPAC name is trans-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,2S)-3,3-difluoro-2-(4-methoxyanilino)cyclohexane-1-carboxylate.
| Compound Name | trans-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,2S)-3,3-difluoro-2-(4-methoxyanilino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 42640324 |
| Molecular Formula | C30H39F2NO3 |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | trans-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,2S)-3,3-difluoro-2-(4-methoxyanilino)cyclohexane-1-carboxylate |
| SMILES | COc1ccc(N[C@H]2[C@@H](C(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)c3ccccc3)CCCC2(F)F)cc1 |
| InChI | InChI=1S/C30H39F2NO3/c1-20-12-17-25(29(2,3)21-9-6-5-7-10-21)26(19-20)36-28(34)24-11-8-18-30(31,32)27(24)33-22-13-15-23(35-4)16-14-22/h5-7,9-10,13-16,20,24-27,33H,8,11-12,17-19H2,1-4H3/t20-,24+,25-,26-,27+/m1/s1 |
| InChIKey | HSMGNNUTGZZBMF-ZGUHPQOJSA-N |
| XLogP | 7.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|