C15H18N2O — CID 639317
(2S,5S)-6-methyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-ol (PubChem CID 639317) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is (2S,5S)-6-methyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-ol.
| Compound Name | (2S,5S)-6-methyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-ol |
|---|---|
| PubChem CID | 639317 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (2S,5S)-6-methyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-ol |
| SMILES | CN1CCc2c3n(c4ccccc24)[C@@H](O)CC[C@@H]31 |
| InChI | InChI=1S/C15H18N2O/c1-16-9-8-11-10-4-2-3-5-12(10)17-14(18)7-6-13(16)15(11)17/h2-5,13-14,18H,6-9H2,1H3/t13-,14-/m0/s1 |
| InChIKey | KCLINVYVZHZNQZ-KBPBESRZSA-N |
| XLogP | 2.45 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |