C27H34N2O2Si — CID 42604682
methyl 9-benzyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate (PubChem CID 42604682) has the molecular formula C27H34N2O2Si and a molecular weight of 446.67 g/mol. Its IUPAC name is methyl 9-benzyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate.
| Compound Name | methyl 9-benzyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 42604682 |
| Molecular Formula | C27H34N2O2Si |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | methyl 9-benzyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
| SMILES | C=C(CC1c2c(c3ccccc3n2Cc2ccccc2)CCN1C(=O)OC)C[Si](C)(C)C |
| InChI | InChI=1S/C27H34N2O2Si/c1-20(19-32(3,4)5)17-25-26-23(15-16-28(25)27(30)31-2)22-13-9-10-14-24(22)29(26)18-21-11-7-6-8-12-21/h6-14,25H,1,15-19H2,2-5H3 |
| InChIKey | XMNFRMAGIZOZHI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|