C28H29N3O3 — CID 57391998
17-benzyl-4-(cyclohexanecarbonyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione (PubChem CID 57391998) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 17-benzyl-4-(cyclohexanecarbonyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione.
| Compound Name | 17-benzyl-4-(cyclohexanecarbonyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione |
|---|---|
| PubChem CID | 57391998 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 17-benzyl-4-(cyclohexanecarbonyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione |
| SMILES | O=C1C(=O)N2CCc3c(n(Cc4ccccc4)c4ccccc34)C2CN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C28H29N3O3/c32-26(20-11-5-2-6-12-20)31-18-24-25-22(15-16-29(24)27(33)28(31)34)21-13-7-8-14-23(21)30(25)17-19-9-3-1-4-10-19/h1,3-4,7-10,13-14,20,24H,2,5-6,11-12,15-18H2 |
| InChIKey | SVYYXGYWYRNXQL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|