C25H26N2O — CID 166835311
12-[[4-[(E)-prop-1-enyl]phenyl]methyl]-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one (PubChem CID 166835311) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 12-[[4-[(E)-prop-1-enyl]phenyl]methyl]-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one.
| Compound Name | 12-[[4-[(E)-prop-1-enyl]phenyl]methyl]-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 166835311 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 12-[[4-[(E)-prop-1-enyl]phenyl]methyl]-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
| SMILES | C/C=C/c1ccc(Cn2c3c(c4ccccc42)CCN2C(=O)CCCC32)cc1 |
| InChI | InChI=1S/C25H26N2O/c1-2-6-18-11-13-19(14-12-18)17-27-22-8-4-3-7-20(22)21-15-16-26-23(25(21)27)9-5-10-24(26)28/h2-4,6-8,11-14,23H,5,9-10,15-17H2,1H3/b6-2+ |
| InChIKey | FQOKHKUYYMCESN-QHHAFSJGSA-N |
| XLogP | 5.33 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|