C22H21N3 — CID 10806131
(1S,11bR)-11-benzyl-1,2,3,5,6,11b-hexahydroindolizino[8,7-b]indole-1-carbonitrile (PubChem CID 10806131) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is (1S,11bR)-11-benzyl-1,2,3,5,6,11b-hexahydroindolizino[8,7-b]indole-1-carbonitrile.
| Compound Name | (1S,11bR)-11-benzyl-1,2,3,5,6,11b-hexahydroindolizino[8,7-b]indole-1-carbonitrile |
|---|---|
| PubChem CID | 10806131 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (1S,11bR)-11-benzyl-1,2,3,5,6,11b-hexahydroindolizino[8,7-b]indole-1-carbonitrile |
| SMILES | N#C[C@H]1CCN2CCc3c(n(Cc4ccccc4)c4ccccc34)[C@@H]12 |
| InChI | InChI=1S/C22H21N3/c23-14-17-10-12-24-13-11-19-18-8-4-5-9-20(18)25(22(19)21(17)24)15-16-6-2-1-3-7-16/h1-9,17,21H,10-13,15H2/t17-,21-/m1/s1 |
| InChIKey | PQZGJYRNMXZLOU-DYESRHJHSA-N |
| XLogP | 4.13 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|