C29H32N2O — CID 57387254
(2R)-2-[(1S)-9-benzyl-1-propyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-2-phenylethanol (PubChem CID 57387254) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is (2R)-2-[(1S)-9-benzyl-1-propyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-2-phenylethanol.
| Compound Name | (2R)-2-[(1S)-9-benzyl-1-propyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 57387254 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (2R)-2-[(1S)-9-benzyl-1-propyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-2-phenylethanol |
| SMILES | CCC[C@H]1c2c(c3ccccc3n2Cc2ccccc2)CCN1[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C29H32N2O/c1-2-11-27-29-25(18-19-30(27)28(21-32)23-14-7-4-8-15-23)24-16-9-10-17-26(24)31(29)20-22-12-5-3-6-13-22/h3-10,12-17,27-28,32H,2,11,18-21H2,1H3/t27-,28-/m0/s1 |
| InChIKey | PILGCVZPRAEUBW-NSOVKSMOSA-N |
| XLogP | 6.12 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|